C23H34O3S2 — CID 134865077
(4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-ol (PubChem CID 134865077) has the molecular formula C23H34O3S2 and a molecular weight of 422.66 g/mol. Its IUPAC name is (4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-ol.
| Compound Name | (4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-ol |
|---|---|
| PubChem CID | 134865077 |
| Molecular Formula | C23H34O3S2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@H](CC1(/C=C/c2ccccc2)SCCCS1)OC(C)OCC |
| InChI | InChI=1S/C23H34O3S2/c1-4-10-21(24)17-22(26-19(3)25-5-2)18-23(27-15-9-16-28-23)14-13-20-11-7-6-8-12-20/h4,6-8,11-14,19,21-22,24H,1,5,9-10,15-18H2,2-3H3/b14-13+/t19?,21-,22+/m0/s1 |
| InChIKey | OXAXTHQRBUNLQD-GQKVNQKWSA-N |
| XLogP | 5.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|