C26H40O3S — CID 146018140
(Z,5R)-8-methyl-11-(oxan-2-yloxy)-2-phenylsulfanyl-5-prop-1-en-2-ylundec-7-en-3-ol (PubChem CID 146018140) has the molecular formula C26H40O3S and a molecular weight of 432.67 g/mol. Its IUPAC name is (Z,5R)-8-methyl-11-(oxan-2-yloxy)-2-phenylsulfanyl-5-prop-1-en-2-ylundec-7-en-3-ol.
| Compound Name | (Z,5R)-8-methyl-11-(oxan-2-yloxy)-2-phenylsulfanyl-5-prop-1-en-2-ylundec-7-en-3-ol |
|---|---|
| PubChem CID | 146018140 |
| Molecular Formula | C26H40O3S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (Z,5R)-8-methyl-11-(oxan-2-yloxy)-2-phenylsulfanyl-5-prop-1-en-2-ylundec-7-en-3-ol |
| SMILES | C=C(C)C(C/C=C(/C)CCCOC1CCCCO1)CC(O)C(C)Sc1ccccc1 |
| InChI | InChI=1S/C26H40O3S/c1-20(2)23(19-25(27)22(4)30-24-12-6-5-7-13-24)16-15-21(3)11-10-18-29-26-14-8-9-17-28-26/h5-7,12-13,15,22-23,25-27H,1,8-11,14,16-19H2,2-4H3/b21-15- |
| InChIKey | CYLBQHFNEPSOEX-QNGOZBTKSA-N |
| XLogP | 6.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|