C20H30O3S2 — CID 11773491
(2S)-4,4-diethoxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]butan-2-ol (PubChem CID 11773491) has the molecular formula C20H30O3S2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (2S)-4,4-diethoxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]butan-2-ol.
| Compound Name | (2S)-4,4-diethoxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 11773491 |
| Molecular Formula | C20H30O3S2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (2S)-4,4-diethoxy-1-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]butan-2-ol |
| SMILES | CCOC(C[C@H](O)CC1(/C=C/c2ccccc2)SCCCS1)OCC |
| InChI | InChI=1S/C20H30O3S2/c1-3-22-19(23-4-2)15-18(21)16-20(24-13-8-14-25-20)12-11-17-9-6-5-7-10-17/h5-7,9-12,18-19,21H,3-4,8,13-16H2,1-2H3/b12-11+/t18-/m0/s1 |
| InChIKey | NYQBQYFQXAAOHG-DXRVJIQQSA-N |
| XLogP | 4.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|