C19H26O2S2 — CID 102052727
2-[(2S)-2-(methoxymethoxy)pent-4-enyl]-2-[(E)-2-phenylethenyl]-1,3-dithiane (PubChem CID 102052727) has the molecular formula C19H26O2S2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2-[(2S)-2-(methoxymethoxy)pent-4-enyl]-2-[(E)-2-phenylethenyl]-1,3-dithiane.
| Compound Name | 2-[(2S)-2-(methoxymethoxy)pent-4-enyl]-2-[(E)-2-phenylethenyl]-1,3-dithiane |
|---|---|
| PubChem CID | 102052727 |
| Molecular Formula | C19H26O2S2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[(2S)-2-(methoxymethoxy)pent-4-enyl]-2-[(E)-2-phenylethenyl]-1,3-dithiane |
| SMILES | C=CC[C@@H](CC1(/C=C/c2ccccc2)SCCCS1)OCOC |
| InChI | InChI=1S/C19H26O2S2/c1-3-8-18(21-16-20-2)15-19(22-13-7-14-23-19)12-11-17-9-5-4-6-10-17/h3-6,9-12,18H,1,7-8,13-16H2,2H3/b12-11+/t18-/m0/s1 |
| InChIKey | IGNHEWFRSBZKPZ-DXRVJIQQSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|