C13H18O2S — CID 10514107
(4S)-4-(benzylsulfanylmethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 10514107) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (4S)-4-(benzylsulfanylmethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-(benzylsulfanylmethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10514107 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (4S)-4-(benzylsulfanylmethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@@H](CSCc2ccccc2)O1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2)14-8-12(15-13)10-16-9-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | ASFNJHFSZHOCNA-LBPRGKRZSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |