C19H24O2S — CID 14207139
[2,2-diethoxyethylsulfanyl(phenyl)methyl]benzene (PubChem CID 14207139) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is [2,2-diethoxyethylsulfanyl(phenyl)methyl]benzene.
| Compound Name | [2,2-diethoxyethylsulfanyl(phenyl)methyl]benzene |
|---|---|
| PubChem CID | 14207139 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [2,2-diethoxyethylsulfanyl(phenyl)methyl]benzene |
| SMILES | CCOC(CSC(c1ccccc1)c1ccccc1)OCC |
| InChI | InChI=1S/C19H24O2S/c1-3-20-18(21-4-2)15-22-19(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18-19H,3-4,15H2,1-2H3 |
| InChIKey | NVXOXXBFKMESNF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|