C31H46O6S — CID 11071652
(6S,9E,13E)-12-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-9,13-dien-4-yne-3,6-diol (PubChem CID 11071652) has the molecular formula C31H46O6S and a molecular weight of 546.77 g/mol. Its IUPAC name is (6S,9E,13E)-12-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-9,13-dien-4-yne-3,6-diol.
| Compound Name | (6S,9E,13E)-12-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-9,13-dien-4-yne-3,6-diol |
|---|---|
| PubChem CID | 11071652 |
| Molecular Formula | C31H46O6S |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | (6S,9E,13E)-12-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-9,13-dien-4-yne-3,6-diol |
| SMILES | C/C(=C\C(C/C(C)=C/CC[C@](C)(O)C#CC(O)C(C)C)S(=O)(=O)c1ccccc1)CCOC1CCCCO1 |
| InChI | InChI=1S/C31H46O6S/c1-24(2)29(32)16-19-31(5,33)18-11-12-25(3)22-28(38(34,35)27-13-7-6-8-14-27)23-26(4)17-21-37-30-15-9-10-20-36-30/h6-8,12-14,23-24,28-30,32-33H,9-11,15,17-18,20-22H2,1-5H3/b25-12+,26-23+/t28?,29?,30?,31-/m0/s1 |
| InChIKey | MATKRDFGLBXDAA-JNULOUSZSA-N |
| XLogP | 5.60 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|