C18H26O4S — CID 139755195
(2S)-2-[4-(benzenesulfonyl)hept-6-en-2-yloxy]oxane (PubChem CID 139755195) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2S)-2-[4-(benzenesulfonyl)hept-6-en-2-yloxy]oxane.
| Compound Name | (2S)-2-[4-(benzenesulfonyl)hept-6-en-2-yloxy]oxane |
|---|---|
| PubChem CID | 139755195 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S)-2-[4-(benzenesulfonyl)hept-6-en-2-yloxy]oxane |
| SMILES | C=CCC(CC(C)O[C@H]1CCCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O4S/c1-3-9-17(23(19,20)16-10-5-4-6-11-16)14-15(2)22-18-12-7-8-13-21-18/h3-6,10-11,15,17-18H,1,7-9,12-14H2,2H3/t15?,17?,18-/m0/s1 |
| InChIKey | BADZDOXIWCOAOE-VJFUWPCTSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|