C18H28O4S — CID 139881595
2-[(3S)-3-(benzenesulfonylmethyl)-2-methylpentan-2-yl]oxyoxane (PubChem CID 139881595) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is 2-[(3S)-3-(benzenesulfonylmethyl)-2-methylpentan-2-yl]oxyoxane.
| Compound Name | 2-[(3S)-3-(benzenesulfonylmethyl)-2-methylpentan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 139881595 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-[(3S)-3-(benzenesulfonylmethyl)-2-methylpentan-2-yl]oxyoxane |
| SMILES | CC[C@H](CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCCO1 |
| InChI | InChI=1S/C18H28O4S/c1-4-15(14-23(19,20)16-10-6-5-7-11-16)18(2,3)22-17-12-8-9-13-21-17/h5-7,10-11,15,17H,4,8-9,12-14H2,1-3H3/t15-,17?/m1/s1 |
| InChIKey | VILAHJRELDNEOX-LDCVWXEPSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |