C13H18O3S — CID 10753455
(4S,6S)-2-(benzenesulfonyl)-4,6-dimethyloxane (PubChem CID 10753455) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is (4S,6S)-2-(benzenesulfonyl)-4,6-dimethyloxane.
| Compound Name | (4S,6S)-2-(benzenesulfonyl)-4,6-dimethyloxane |
|---|---|
| PubChem CID | 10753455 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (4S,6S)-2-(benzenesulfonyl)-4,6-dimethyloxane |
| SMILES | C[C@@H]1CC(S(=O)(=O)c2ccccc2)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H18O3S/c1-10-8-11(2)16-13(9-10)17(14,15)12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3/t10-,11-,13?/m0/s1 |
| InChIKey | YRADGLNTGJJBFL-WAQLSPKVSA-N |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |