C17H26O4S — CID 14443723
2-[(3S)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane (PubChem CID 14443723) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-[(3S)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane.
| Compound Name | 2-[(3S)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 14443723 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-[(3S)-4-(benzenesulfonyl)-2,3-dimethylbutan-2-yl]oxyoxane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCCO1 |
| InChI | InChI=1S/C17H26O4S/c1-14(13-22(18,19)15-9-5-4-6-10-15)17(2,3)21-16-11-7-8-12-20-16/h4-6,9-10,14,16H,7-8,11-13H2,1-3H3/t14-,16?/m1/s1 |
| InChIKey | BXLVDRBXXXGMES-IURRXHLWSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |