C19H30O4S — CID 139881592
2-[(3R)-3-(benzenesulfonylmethyl)-2-methylhexan-2-yl]oxyoxane (PubChem CID 139881592) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is 2-[(3R)-3-(benzenesulfonylmethyl)-2-methylhexan-2-yl]oxyoxane.
| Compound Name | 2-[(3R)-3-(benzenesulfonylmethyl)-2-methylhexan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 139881592 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[(3R)-3-(benzenesulfonylmethyl)-2-methylhexan-2-yl]oxyoxane |
| SMILES | CCC[C@@H](CS(=O)(=O)c1ccccc1)C(C)(C)OC1CCCCO1 |
| InChI | InChI=1S/C19H30O4S/c1-4-10-16(15-24(20,21)17-11-6-5-7-12-17)19(2,3)23-18-13-8-9-14-22-18/h5-7,11-12,16,18H,4,8-10,13-15H2,1-3H3/t16-,18?/m0/s1 |
| InChIKey | SRQBVCNMDQBQMW-ATNAJCNCSA-N |
| XLogP | 4.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |