C21H34O3S — CID 15456613
5-(1-ethoxyethoxy)-1-(1-phenylsulfanylcyclohexyl)pentan-1-ol (PubChem CID 15456613) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is 5-(1-ethoxyethoxy)-1-(1-phenylsulfanylcyclohexyl)pentan-1-ol.
| Compound Name | 5-(1-ethoxyethoxy)-1-(1-phenylsulfanylcyclohexyl)pentan-1-ol |
|---|---|
| PubChem CID | 15456613 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 5-(1-ethoxyethoxy)-1-(1-phenylsulfanylcyclohexyl)pentan-1-ol |
| SMILES | CCOC(C)OCCCCC(O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H34O3S/c1-3-23-18(2)24-17-11-8-14-20(22)21(15-9-5-10-16-21)25-19-12-6-4-7-13-19/h4,6-7,12-13,18,20,22H,3,5,8-11,14-17H2,1-2H3 |
| InChIKey | WNLNQKHBFBHOTE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|