C21H34O2S — CID 15456618
1-(1-phenylsulfanylcyclohexyl)nonane-1,9-diol (PubChem CID 15456618) has the molecular formula C21H34O2S and a molecular weight of 350.57 g/mol. Its IUPAC name is 1-(1-phenylsulfanylcyclohexyl)nonane-1,9-diol.
| Compound Name | 1-(1-phenylsulfanylcyclohexyl)nonane-1,9-diol |
|---|---|
| PubChem CID | 15456618 |
| Molecular Formula | C21H34O2S |
| Molecular Weight | 350.57 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 1-(1-phenylsulfanylcyclohexyl)nonane-1,9-diol |
| SMILES | OCCCCCCCCC(O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H34O2S/c22-18-12-4-2-1-3-9-15-20(23)21(16-10-6-11-17-21)24-19-13-7-5-8-14-19/h5,7-8,13-14,20,22-23H,1-4,6,9-12,15-18H2 |
| InChIKey | FFHLKSWZUTVNAP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|