C19H30O2S — CID 15456616
1-(1-phenylsulfanylcyclohexyl)heptane-1,7-diol (PubChem CID 15456616) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is 1-(1-phenylsulfanylcyclohexyl)heptane-1,7-diol.
| Compound Name | 1-(1-phenylsulfanylcyclohexyl)heptane-1,7-diol |
|---|---|
| PubChem CID | 15456616 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-(1-phenylsulfanylcyclohexyl)heptane-1,7-diol |
| SMILES | OCCCCCCC(O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H30O2S/c20-16-10-2-1-7-13-18(21)19(14-8-4-9-15-19)22-17-11-5-3-6-12-17/h3,5-6,11-12,18,20-21H,1-2,4,7-10,13-16H2 |
| InChIKey | NWCKDKQYVLSPLD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|