C18H28O2S — CID 15880851
1-(1-phenylsulfanylcyclohexyl)hexane-1,6-diol (PubChem CID 15880851) has the molecular formula C18H28O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is 1-(1-phenylsulfanylcyclohexyl)hexane-1,6-diol.
| Compound Name | 1-(1-phenylsulfanylcyclohexyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 15880851 |
| Molecular Formula | C18H28O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(1-phenylsulfanylcyclohexyl)hexane-1,6-diol |
| SMILES | OCCCCCC(O)C1(Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H28O2S/c19-15-9-2-6-12-17(20)18(13-7-3-8-14-18)21-16-10-4-1-5-11-16/h1,4-5,10-11,17,19-20H,2-3,6-9,12-15H2 |
| InChIKey | WCMJESZDHYFRGS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|