C26H38O2S — CID 146018142
2-[(4Z,7R)-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundeca-4,9-dienoxy]oxane (PubChem CID 146018142) has the molecular formula C26H38O2S and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-[(4Z,7R)-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundeca-4,9-dienoxy]oxane.
| Compound Name | 2-[(4Z,7R)-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundeca-4,9-dienoxy]oxane |
|---|---|
| PubChem CID | 146018142 |
| Molecular Formula | C26H38O2S |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-[(4Z,7R)-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundeca-4,9-dienoxy]oxane |
| SMILES | C=C(C)[C@H](C/C=C(/C)CCCOC1CCCCO1)CC(=CC)Sc1ccccc1 |
| InChI | InChI=1S/C26H38O2S/c1-5-24(29-25-13-7-6-8-14-25)20-23(21(2)3)17-16-22(4)12-11-19-28-26-15-9-10-18-27-26/h5-8,13-14,16,23,26H,2,9-12,15,17-20H2,1,3-4H3/b22-16-,24-5?/t23-,26?/m1/s1 |
| InChIKey | NOXHMTDUTXLPJM-BYSODDSWSA-N |
| XLogP | 7.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|