C26H39ClO2S — CID 146018141
2-[(Z,7R)-10-chloro-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundec-4-enoxy]oxane (PubChem CID 146018141) has the molecular formula C26H39ClO2S and a molecular weight of 451.12 g/mol. Its IUPAC name is 2-[(Z,7R)-10-chloro-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundec-4-enoxy]oxane.
| Compound Name | 2-[(Z,7R)-10-chloro-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundec-4-enoxy]oxane |
|---|---|
| PubChem CID | 146018141 |
| Molecular Formula | C26H39ClO2S |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[(Z,7R)-10-chloro-4-methyl-9-phenylsulfanyl-7-prop-1-en-2-ylundec-4-enoxy]oxane |
| SMILES | C=C(C)[C@H](C/C=C(/C)CCCOC1CCCCO1)CC(Sc1ccccc1)C(C)Cl |
| InChI | InChI=1S/C26H39ClO2S/c1-20(2)23(19-25(22(4)27)30-24-12-6-5-7-13-24)16-15-21(3)11-10-18-29-26-14-8-9-17-28-26/h5-7,12-13,15,22-23,25-26H,1,8-11,14,16-19H2,2-4H3/b21-15-/t22?,23-,25?,26?/m1/s1 |
| InChIKey | RWWWMDYXAFRZRG-MMORNNNYSA-N |
| XLogP | 8.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|