C18H23ClO2S — CID 166109152
2-[(2-chlorocyclohexa-1,5-dien-1-yl)methyl]-1-ethoxy-3-phenylsulfanylpropan-1-ol (PubChem CID 166109152) has the molecular formula C18H23ClO2S and a molecular weight of 338.90 g/mol. Its IUPAC name is 2-[(2-chlorocyclohexa-1,5-dien-1-yl)methyl]-1-ethoxy-3-phenylsulfanylpropan-1-ol.
| Compound Name | 2-[(2-chlorocyclohexa-1,5-dien-1-yl)methyl]-1-ethoxy-3-phenylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 166109152 |
| Molecular Formula | C18H23ClO2S |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[(2-chlorocyclohexa-1,5-dien-1-yl)methyl]-1-ethoxy-3-phenylsulfanylpropan-1-ol |
| SMILES | CCOC(O)C(CSc1ccccc1)CC1=C(Cl)CCC=C1 |
| InChI | InChI=1S/C18H23ClO2S/c1-2-21-18(20)15(12-14-8-6-7-11-17(14)19)13-22-16-9-4-3-5-10-16/h3-6,8-10,15,18,20H,2,7,11-13H2,1H3 |
| InChIKey | ZZHISTGJFFXWDI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|