C19H30O4S2 — CID 562623
3-(1-methoxyethoxy)-1-(2-methyl-1,3-dithian-2-yl)-4-phenylmethoxybutan-2-ol (PubChem CID 562623) has the molecular formula C19H30O4S2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 3-(1-methoxyethoxy)-1-(2-methyl-1,3-dithian-2-yl)-4-phenylmethoxybutan-2-ol.
| Compound Name | 3-(1-methoxyethoxy)-1-(2-methyl-1,3-dithian-2-yl)-4-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 562623 |
| Molecular Formula | C19H30O4S2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 3-(1-methoxyethoxy)-1-(2-methyl-1,3-dithian-2-yl)-4-phenylmethoxybutan-2-ol |
| SMILES | COC(C)OC(COCc1ccccc1)C(O)CC1(C)SCCCS1 |
| InChI | InChI=1S/C19H30O4S2/c1-15(21-3)23-18(14-22-13-16-8-5-4-6-9-16)17(20)12-19(2)24-10-7-11-25-19/h4-6,8-9,15,17-18,20H,7,10-14H2,1-3H3 |
| InChIKey | BRAPPJDXLPDPHB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|