C26H36O4S2 — CID 11518555
[(4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-yl] prop-2-enoate (PubChem CID 11518555) has the molecular formula C26H36O4S2 and a molecular weight of 476.70 g/mol. Its IUPAC name is [(4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11518555 |
| Molecular Formula | C26H36O4S2 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [(4S,6R)-6-(1-ethoxyethoxy)-7-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]hept-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@@H](C[C@H](CC1(/C=C/c2ccccc2)SCCCS1)OC(C)OCC)OC(=O)C=C |
| InChI | InChI=1S/C26H36O4S2/c1-5-12-23(30-25(27)6-2)19-24(29-21(4)28-7-3)20-26(31-17-11-18-32-26)16-15-22-13-9-8-10-14-22/h5-6,8-10,13-16,21,23-24H,1-2,7,11-12,17-20H2,3-4H3/b16-15+/t21?,23-,24+/m0/s1 |
| InChIKey | RMSSLIYSZBNAPN-ZEMRHFCUSA-N |
| XLogP | 6.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|