C14H20OS2 — CID 14569687
1-(2-phenyl-1,3-dithian-2-yl)butan-1-ol (PubChem CID 14569687) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-(2-phenyl-1,3-dithian-2-yl)butan-1-ol.
| Compound Name | 1-(2-phenyl-1,3-dithian-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 14569687 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2-phenyl-1,3-dithian-2-yl)butan-1-ol |
| SMILES | CCCC(O)C1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C14H20OS2/c1-2-7-13(15)14(16-10-6-11-17-14)12-8-4-3-5-9-12/h3-5,8-9,13,15H,2,6-7,10-11H2,1H3 |
| InChIKey | KAZULJVGRDEIGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |