C17H17FOS2 — CID 134878222
(2-fluorophenyl)-(2-phenyl-1,3-dithian-2-yl)methanol (PubChem CID 134878222) has the molecular formula C17H17FOS2 and a molecular weight of 320.45 g/mol. Its IUPAC name is (2-fluorophenyl)-(2-phenyl-1,3-dithian-2-yl)methanol.
| Compound Name | (2-fluorophenyl)-(2-phenyl-1,3-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 134878222 |
| Molecular Formula | C17H17FOS2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (2-fluorophenyl)-(2-phenyl-1,3-dithian-2-yl)methanol |
| SMILES | OC(c1ccccc1F)C1(c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C17H17FOS2/c18-15-10-5-4-9-14(15)16(19)17(20-11-6-12-21-17)13-7-2-1-3-8-13/h1-5,7-10,16,19H,6,11-12H2 |
| InChIKey | ORYZECXEYUULMS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |