C16H24OS2 — CID 135038264
1-(5-ethyl-2-phenyl-1,3-dithian-2-yl)butan-1-ol (PubChem CID 135038264) has the molecular formula C16H24OS2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-(5-ethyl-2-phenyl-1,3-dithian-2-yl)butan-1-ol.
| Compound Name | 1-(5-ethyl-2-phenyl-1,3-dithian-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 135038264 |
| Molecular Formula | C16H24OS2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(5-ethyl-2-phenyl-1,3-dithian-2-yl)butan-1-ol |
| SMILES | CCCC(O)C1(c2ccccc2)SCC(CC)CS1 |
| InChI | InChI=1S/C16H24OS2/c1-3-8-15(17)16(14-9-6-5-7-10-14)18-11-13(4-2)12-19-16/h5-7,9-10,13,15,17H,3-4,8,11-12H2,1-2H3 |
| InChIKey | SLWSDMOOUJCGHW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |