C15H24OS2Si — CID 14508433
1-phenyl-2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol (PubChem CID 14508433) has the molecular formula C15H24OS2Si and a molecular weight of 312.58 g/mol. Its IUPAC name is 1-phenyl-2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol.
| Compound Name | 1-phenyl-2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 14508433 |
| Molecular Formula | C15H24OS2Si |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-phenyl-2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol |
| SMILES | C[Si](C)(C)C1(CC(O)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C15H24OS2Si/c1-19(2,3)15(17-10-7-11-18-15)12-14(16)13-8-5-4-6-9-13/h4-6,8-9,14,16H,7,10-12H2,1-3H3 |
| InChIKey | GZOBYLBRTFCWSC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|