C30H46O3S2Si — CID 134930050
(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[(2S)-5-hydroxypentan-2-yl]-1,3-dithiolan-2-yl]pentan-1-ol (PubChem CID 134930050) has the molecular formula C30H46O3S2Si and a molecular weight of 546.92 g/mol. Its IUPAC name is (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[(2S)-5-hydroxypentan-2-yl]-1,3-dithiolan-2-yl]pentan-1-ol.
| Compound Name | (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[(2S)-5-hydroxypentan-2-yl]-1,3-dithiolan-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 134930050 |
| Molecular Formula | C30H46O3S2Si |
| Molecular Weight | 546.92 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[2-[(2S)-5-hydroxypentan-2-yl]-1,3-dithiolan-2-yl]pentan-1-ol |
| SMILES | C[C@@H](CCCO)C1([C@@H](C)CC(CO)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCS1 |
| InChI | InChI=1S/C30H46O3S2Si/c1-24(13-12-18-31)30(34-19-20-35-30)25(2)21-26(22-32)23-33-36(29(3,4)5,27-14-8-6-9-15-27)28-16-10-7-11-17-28/h6-11,14-17,24-26,31-32H,12-13,18-23H2,1-5H3/t24-,25-,26?/m0/s1 |
| InChIKey | HMHKEXYONNZMFA-NPGWBMRXSA-N |
| XLogP | 5.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.92 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|