C27H40O3S2Si — CID 139116864
(3S,4R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)heptane-1,4-diol (PubChem CID 139116864) has the molecular formula C27H40O3S2Si and a molecular weight of 504.83 g/mol. Its IUPAC name is (3S,4R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)heptane-1,4-diol.
| Compound Name | (3S,4R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)heptane-1,4-diol |
|---|---|
| PubChem CID | 139116864 |
| Molecular Formula | C27H40O3S2Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (3S,4R,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-(1,3-dithian-2-yl)heptane-1,4-diol |
| SMILES | C[C@@H](C[C@@H](O)[C@H](CCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C27H40O3S2Si/c1-21(26-31-18-11-19-32-26)20-24(29)25(16-17-28)30-33(27(2,3)4,22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,21,24-26,28-29H,11,16-20H2,1-4H3/t21-,24+,25-/m0/s1 |
| InChIKey | VYCNBVOZKQUOFP-GPUOULLFSA-N |
| XLogP | 4.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|