C33H50O5S2Si — CID 134936365
(E)-1-[2-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(2-methoxyethoxymethoxy)-3-methylbutyl]-1,3-dithian-2-yl]but-2-en-1-ol (PubChem CID 134936365) has the molecular formula C33H50O5S2Si and a molecular weight of 618.98 g/mol. Its IUPAC name is (E)-1-[2-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(2-methoxyethoxymethoxy)-3-methylbutyl]-1,3-dithian-2-yl]but-2-en-1-ol.
| Compound Name | (E)-1-[2-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(2-methoxyethoxymethoxy)-3-methylbutyl]-1,3-dithian-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 134936365 |
| Molecular Formula | C33H50O5S2Si |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | (E)-1-[2-[(2S,3R)-4-[tert-butyl(diphenyl)silyl]oxy-2-(2-methoxyethoxymethoxy)-3-methylbutyl]-1,3-dithian-2-yl]but-2-en-1-ol |
| SMILES | C/C=C/C(O)C1(C[C@H](OCOCCOC)[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C33H50O5S2Si/c1-7-15-31(34)33(39-22-14-23-40-33)24-30(37-26-36-21-20-35-6)27(2)25-38-41(32(3,4)5,28-16-10-8-11-17-28)29-18-12-9-13-19-29/h7-13,15-19,27,30-31,34H,14,20-26H2,1-6H3/b15-7+/t27-,30+,31?/m1/s1 |
| InChIKey | RXIHTRQVGHVSAO-GAUIOGQUSA-N |
| XLogP | 6.10 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|