C30H44O6S2Si — CID 11072028
tert-butyl-[(2R)-2-(methoxymethoxy)-2-[(8R,9S)-9-(methoxymethoxy)-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]ethoxy]-diphenylsilane (PubChem CID 11072028) has the molecular formula C30H44O6S2Si and a molecular weight of 592.90 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-(methoxymethoxy)-2-[(8R,9S)-9-(methoxymethoxy)-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-2-(methoxymethoxy)-2-[(8R,9S)-9-(methoxymethoxy)-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11072028 |
| Molecular Formula | C30H44O6S2Si |
| Molecular Weight | 592.90 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | tert-butyl-[(2R)-2-(methoxymethoxy)-2-[(8R,9S)-9-(methoxymethoxy)-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]ethoxy]-diphenylsilane |
| SMILES | COCO[C@H]1CCC2(O[C@H]1[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC)SCCCS2 |
| InChI | InChI=1S/C30H44O6S2Si/c1-29(2,3)39(24-13-8-6-9-14-24,25-15-10-7-11-16-25)35-21-27(34-23-32-5)28-26(33-22-31-4)17-18-30(36-28)37-19-12-20-38-30/h6-11,13-16,26-28H,12,17-23H2,1-5H3/t26-,27+,28+/m0/s1 |
| InChIKey | WHNHYESSJJHVDT-UPRLRBBYSA-N |
| XLogP | 5.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|