C32H48O3S2Si — CID 134936240
tert-butyl-[4-[2-[3-(oxan-2-yloxy)propyl]-1,3-dithian-2-yl]butoxy]-diphenylsilane (PubChem CID 134936240) has the molecular formula C32H48O3S2Si and a molecular weight of 572.95 g/mol. Its IUPAC name is tert-butyl-[4-[2-[3-(oxan-2-yloxy)propyl]-1,3-dithian-2-yl]butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-[2-[3-(oxan-2-yloxy)propyl]-1,3-dithian-2-yl]butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134936240 |
| Molecular Formula | C32H48O3S2Si |
| Molecular Weight | 572.95 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | tert-butyl-[4-[2-[3-(oxan-2-yloxy)propyl]-1,3-dithian-2-yl]butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCC1(CCCOC2CCCCO2)SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H48O3S2Si/c1-31(2,3)38(28-16-6-4-7-17-28,29-18-8-5-9-19-29)35-25-13-11-21-32(36-26-15-27-37-32)22-14-24-34-30-20-10-12-23-33-30/h4-9,16-19,30H,10-15,20-27H2,1-3H3 |
| InChIKey | XZKKBEXWSWLJOJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.95 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|