C35H54O5S2Si — CID 134881831
tert-butyl-[2-[(4S,6S)-6-[(2S)-3-(1,3-dithian-2-yl)-2-(methoxymethoxy)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane (PubChem CID 134881831) has the molecular formula C35H54O5S2Si and a molecular weight of 647.03 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,6S)-6-[(2S)-3-(1,3-dithian-2-yl)-2-(methoxymethoxy)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4S,6S)-6-[(2S)-3-(1,3-dithian-2-yl)-2-(methoxymethoxy)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134881831 |
| Molecular Formula | C35H54O5S2Si |
| Molecular Weight | 647.03 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | tert-butyl-[2-[(4S,6S)-6-[(2S)-3-(1,3-dithian-2-yl)-2-(methoxymethoxy)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
| SMILES | COCO[C@@H](C[C@@H]1C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1)C(C)(C)C1SCCCS1 |
| InChI | InChI=1S/C35H54O5S2Si/c1-33(2,3)43(29-16-11-9-12-17-29,30-18-13-10-14-19-30)38-21-20-27-24-28(40-35(6,7)39-27)25-31(37-26-36-8)34(4,5)32-41-22-15-23-42-32/h9-14,16-19,27-28,31-32H,15,20-26H2,1-8H3/t27-,28-,31-/m0/s1 |
| InChIKey | FYXXKJMUGJRFBG-QYDYLWNGSA-N |
| XLogP | 7.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.03 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|