C35H54O5Si — CID 10897190
tert-butyl-diphenyl-[(2R)-2-[(4R,5S,6R)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propoxy]silane (PubChem CID 10897190) has the molecular formula C35H54O5Si and a molecular weight of 582.90 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2R)-2-[(4R,5S,6R)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propoxy]silane.
| Compound Name | tert-butyl-diphenyl-[(2R)-2-[(4R,5S,6R)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propoxy]silane |
|---|---|
| PubChem CID | 10897190 |
| Molecular Formula | C35H54O5Si |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | tert-butyl-diphenyl-[(2R)-2-[(4R,5S,6R)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propoxy]silane |
| SMILES | C[C@@H]1[C@@H]([C@H](C)[C@H]2OC(C)(C)OC[C@@H]2C)OC(C)(C)O[C@@H]1[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H54O5Si/c1-24-22-36-34(8,9)38-30(24)26(3)32-27(4)31(39-35(10,11)40-32)25(2)23-37-41(33(5,6)7,28-18-14-12-15-19-28)29-20-16-13-17-21-29/h12-21,24-27,30-32H,22-23H2,1-11H3/t24-,25+,26+,27-,30-,31+,32+/m0/s1 |
| InChIKey | WOYVFCCPZWTWRU-XAPHVVPESA-N |
| XLogP | 6.78 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|