C29H42O2S2Si — CID 10697163
tert-butyl-[(2S)-2-[(8R,11S)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]butoxy]-diphenylsilane (PubChem CID 10697163) has the molecular formula C29H42O2S2Si and a molecular weight of 514.87 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(8R,11S)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(8R,11S)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10697163 |
| Molecular Formula | C29H42O2S2Si |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | tert-butyl-[(2S)-2-[(8R,11S)-11-methyl-7-oxa-1,5-dithiaspiro[5.5]undecan-8-yl]butoxy]-diphenylsilane |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC[C@H](C)C2(O1)SCCCS2 |
| InChI | InChI=1S/C29H42O2S2Si/c1-6-24(27-19-18-23(2)29(31-27)32-20-13-21-33-29)22-30-34(28(3,4)5,25-14-9-7-10-15-25)26-16-11-8-12-17-26/h7-12,14-17,23-24,27H,6,13,18-22H2,1-5H3/t23-,24-,27+/m0/s1 |
| InChIKey | ZOHMMHLNRNKBOK-NLJOTIRTSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|