C25H36OS2Si — CID 24755802
tert-butyl-[(3R)-4-(1,3-dithian-2-yl)-3-methylbutoxy]-diphenylsilane (PubChem CID 24755802) has the molecular formula C25H36OS2Si and a molecular weight of 444.78 g/mol. Its IUPAC name is tert-butyl-[(3R)-4-(1,3-dithian-2-yl)-3-methylbutoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3R)-4-(1,3-dithian-2-yl)-3-methylbutoxy]-diphenylsilane |
|---|---|
| PubChem CID | 24755802 |
| Molecular Formula | C25H36OS2Si |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl-[(3R)-4-(1,3-dithian-2-yl)-3-methylbutoxy]-diphenylsilane |
| SMILES | C[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC1SCCCS1 |
| InChI | InChI=1S/C25H36OS2Si/c1-21(20-24-27-18-11-19-28-24)16-17-26-29(25(2,3)4,22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,21,24H,11,16-20H2,1-4H3/t21-/m1/s1 |
| InChIKey | HGMHIIAPHWUILB-OAQYLSRUSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|