C25H34OSSi — CID 11732356
tert-butyl-[[(2S)-5-tert-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane (PubChem CID 11732356) has the molecular formula C25H34OSSi and a molecular weight of 410.70 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-tert-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-5-tert-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11732356 |
| Molecular Formula | C25H34OSSi |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | tert-butyl-[[(2S)-5-tert-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)C1=CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1 |
| InChI | InChI=1S/C25H34OSSi/c1-24(2,3)23-18-17-20(27-23)19-26-28(25(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,18,20H,17,19H2,1-6H3/t20-/m0/s1 |
| InChIKey | QVVSBCYBWUBEMI-FQEVSTJZSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|