C21H26O2SSi — CID 11728378
(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-one (PubChem CID 11728378) has the molecular formula C21H26O2SSi and a molecular weight of 370.59 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-one.
| Compound Name | (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-one |
|---|---|
| PubChem CID | 11728378 |
| Molecular Formula | C21H26O2SSi |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC(=O)S1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O2SSi/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-16-17-14-15-20(22)24-17/h4-13,17H,14-16H2,1-3H3/t17-/m0/s1 |
| InChIKey | IYHYJPNUNDIUQJ-KRWDZBQOSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|