C24H31FO4SSi — CID 85297680
methyl 4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoate (PubChem CID 85297680) has the molecular formula C24H31FO4SSi and a molecular weight of 462.66 g/mol. Its IUPAC name is methyl 4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoate.
| Compound Name | methyl 4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoate |
|---|---|
| PubChem CID | 85297680 |
| Molecular Formula | C24H31FO4SSi |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | methyl 4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoate |
| SMILES | COC(=O)C(F)CC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)SC(C)=O |
| InChI | InChI=1S/C24H31FO4SSi/c1-18(26)30-19(16-22(25)23(27)28-5)17-29-31(24(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22H,16-17H2,1-5H3 |
| InChIKey | UASOOOQYIHQYMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|