C23H29FO3SSi — CID 141390588
[tert-butyl(diphenyl)silyl]oxymethyl 2-(3-fluorothiolan-2-yl)acetate (PubChem CID 141390588) has the molecular formula C23H29FO3SSi and a molecular weight of 432.63 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl]oxymethyl 2-(3-fluorothiolan-2-yl)acetate.
| Compound Name | [tert-butyl(diphenyl)silyl]oxymethyl 2-(3-fluorothiolan-2-yl)acetate |
|---|---|
| PubChem CID | 141390588 |
| Molecular Formula | C23H29FO3SSi |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [tert-butyl(diphenyl)silyl]oxymethyl 2-(3-fluorothiolan-2-yl)acetate |
| SMILES | CC(C)(C)[Si](OCOC(=O)CC1SCCC1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29FO3SSi/c1-23(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-17-26-22(25)16-21-20(24)14-15-28-21/h4-13,20-21H,14-17H2,1-3H3 |
| InChIKey | UMPQEHFRSNLRIR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|