C21H25FO2SSi — CID 13009258
(3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorothiolan-2-one (PubChem CID 13009258) has the molecular formula C21H25FO2SSi and a molecular weight of 388.58 g/mol. Its IUPAC name is (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorothiolan-2-one.
| Compound Name | (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorothiolan-2-one |
|---|---|
| PubChem CID | 13009258 |
| Molecular Formula | C21H25FO2SSi |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorothiolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H](F)C(=O)S1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25FO2SSi/c1-21(2,3)26(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-15-16-14-19(22)20(23)25-16/h4-13,16,19H,14-15H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | FIOAXJSUVBOXAZ-VQIMIIECSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|