C23H29FO4SSi — CID 141069683
(2S)-4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoic acid (PubChem CID 141069683) has the molecular formula C23H29FO4SSi and a molecular weight of 448.63 g/mol. Its IUPAC name is (2S)-4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoic acid.
| Compound Name | (2S)-4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoic acid |
|---|---|
| PubChem CID | 141069683 |
| Molecular Formula | C23H29FO4SSi |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (2S)-4-acetylsulfanyl-5-[tert-butyl(diphenyl)silyl]oxy-2-fluoropentanoic acid |
| SMILES | CC(=O)SC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](F)C(=O)O |
| InChI | InChI=1S/C23H29FO4SSi/c1-17(25)29-18(15-21(24)22(26)27)16-28-30(23(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,18,21H,15-16H2,1-4H3,(H,26,27)/t18?,21-/m0/s1 |
| InChIKey | ZMLZYBSAKXYYOF-ZYZRXSCRSA-N |
| XLogP | 4.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|