C25H34OSSi — CID 15191434
tert-butyl-[[(2S)-5-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane (PubChem CID 15191434) has the molecular formula C25H34OSSi and a molecular weight of 410.70 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-5-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 15191434 |
| Molecular Formula | C25H34OSSi |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | tert-butyl-[[(2S)-5-butyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
| SMILES | CCCCC1=CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1 |
| InChI | InChI=1S/C25H34OSSi/c1-5-6-13-21-18-19-22(27-21)20-26-28(25(2,3)4,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-12,14-18,22H,5-6,13,19-20H2,1-4H3/t22-/m0/s1 |
| InChIKey | CWNQNISATTYFDZ-QFIPXVFZSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|