C27H37FOS2Si — CID 139774219
tert-butyl-[(E)-7-(1,3-dithian-2-yl)-5-fluorohept-5-enoxy]-diphenylsilane (PubChem CID 139774219) has the molecular formula C27H37FOS2Si and a molecular weight of 488.81 g/mol. Its IUPAC name is tert-butyl-[(E)-7-(1,3-dithian-2-yl)-5-fluorohept-5-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-7-(1,3-dithian-2-yl)-5-fluorohept-5-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 139774219 |
| Molecular Formula | C27H37FOS2Si |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | tert-butyl-[(E)-7-(1,3-dithian-2-yl)-5-fluorohept-5-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCC/C(F)=C\CC1SCCCS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37FOS2Si/c1-27(2,3)32(24-14-6-4-7-15-24,25-16-8-5-9-17-25)29-20-11-10-13-23(28)18-19-26-30-21-12-22-31-26/h4-9,14-18,26H,10-13,19-22H2,1-3H3/b23-18+ |
| InChIKey | VUKLKMHKXBEMDG-PTGBLXJZSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|