C25H36OSSi2 — CID 15191439
tert-butyl-diphenyl-[[(2S)-5-(trimethylsilylmethyl)-2,3-dihydrothiophen-2-yl]methoxy]silane (PubChem CID 15191439) has the molecular formula C25H36OSSi2 and a molecular weight of 440.80 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2S)-5-(trimethylsilylmethyl)-2,3-dihydrothiophen-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2S)-5-(trimethylsilylmethyl)-2,3-dihydrothiophen-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 15191439 |
| Molecular Formula | C25H36OSSi2 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | tert-butyl-diphenyl-[[(2S)-5-(trimethylsilylmethyl)-2,3-dihydrothiophen-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC=C(C[Si](C)(C)C)S1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36OSSi2/c1-25(2,3)29(23-13-9-7-10-14-23,24-15-11-8-12-16-24)26-19-21-17-18-22(27-21)20-28(4,5)6/h7-16,18,21H,17,19-20H2,1-6H3/t21-/m0/s1 |
| InChIKey | AAHPGJTYDJPFTM-NRFANRHFSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|