C21H26OSSi — CID 11501276
tert-butyl-[[(2S)-3-methylidenethietan-2-yl]methoxy]-diphenylsilane (PubChem CID 11501276) has the molecular formula C21H26OSSi and a molecular weight of 354.59 g/mol. Its IUPAC name is tert-butyl-[[(2S)-3-methylidenethietan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-3-methylidenethietan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11501276 |
| Molecular Formula | C21H26OSSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | tert-butyl-[[(2S)-3-methylidenethietan-2-yl]methoxy]-diphenylsilane |
| SMILES | C=C1CS[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H26OSSi/c1-17-16-23-20(17)15-22-24(21(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,1,15-16H2,2-4H3/t20-/m1/s1 |
| InChIKey | WFRLEMUXCBNLBY-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|