C21H28O2SSi — CID 11588825
[(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methanol (PubChem CID 11588825) has the molecular formula C21H28O2SSi and a molecular weight of 372.61 g/mol. Its IUPAC name is [(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methanol.
| Compound Name | [(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methanol |
|---|---|
| PubChem CID | 11588825 |
| Molecular Formula | C21H28O2SSi |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1SC[C@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2SSi/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-15-20-17(14-22)16-24-20/h4-13,17,20,22H,14-16H2,1-3H3/t17-,20-/m1/s1 |
| InChIKey | AYALSQPHTABIPF-YLJYHZDGSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|