C37H46O2SSi2 — CID 11592505
tert-butyl-[[(2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methoxy]-diphenylsilane (PubChem CID 11592505) has the molecular formula C37H46O2SSi2 and a molecular weight of 611.01 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11592505 |
| Molecular Formula | C37H46O2SSi2 |
| Molecular Weight | 611.01 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | tert-butyl-[[(2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-3-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1CS[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H46O2SSi2/c1-36(2,3)41(31-19-11-7-12-20-31,32-21-13-8-14-22-32)38-27-30-29-40-35(30)28-39-42(37(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,30,35H,27-29H2,1-6H3/t30-,35+/m0/s1 |
| InChIKey | LSPJROZFBYHJEY-LWQYYNMXSA-N |
| XLogP | 6.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.01 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|