C34H46OSSi2 — CID 134847832
tert-butyl-[(2Z)-2-[butylsulfanyl(triphenylsilyl)methylidene]-3-methylcyclobutyl]oxy-dimethylsilane (PubChem CID 134847832) has the molecular formula C34H46OSSi2 and a molecular weight of 558.98 g/mol. Its IUPAC name is tert-butyl-[(2Z)-2-[butylsulfanyl(triphenylsilyl)methylidene]-3-methylcyclobutyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2Z)-2-[butylsulfanyl(triphenylsilyl)methylidene]-3-methylcyclobutyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134847832 |
| Molecular Formula | C34H46OSSi2 |
| Molecular Weight | 558.98 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | tert-butyl-[(2Z)-2-[butylsulfanyl(triphenylsilyl)methylidene]-3-methylcyclobutyl]oxy-dimethylsilane |
| SMILES | CCCCS/C(=C1/C(C)CC1O[Si](C)(C)C(C)(C)C)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H46OSSi2/c1-8-9-25-36-33(32-27(2)26-31(32)35-37(6,7)34(3,4)5)38(28-19-13-10-14-20-28,29-21-15-11-16-22-29)30-23-17-12-18-24-30/h10-24,27,31H,8-9,25-26H2,1-7H3/b33-32+ |
| InChIKey | CPESVVXLKAGLRQ-ULIFNZDWSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.98 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|