C30H38OSi2 — CID 132503824
tert-butyl-dimethyl-[(1S,2Z,3R)-3-methyl-2-(triphenylsilylmethylidene)cyclobutyl]oxysilane (PubChem CID 132503824) has the molecular formula C30H38OSi2 and a molecular weight of 470.81 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2Z,3R)-3-methyl-2-(triphenylsilylmethylidene)cyclobutyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S,2Z,3R)-3-methyl-2-(triphenylsilylmethylidene)cyclobutyl]oxysilane |
|---|---|
| PubChem CID | 132503824 |
| Molecular Formula | C30H38OSi2 |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2Z,3R)-3-methyl-2-(triphenylsilylmethylidene)cyclobutyl]oxysilane |
| SMILES | C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)/C1=C\[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H38OSi2/c1-24-22-29(31-32(5,6)30(2,3)4)28(24)23-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,23-24,29H,22H2,1-6H3/b28-23-/t24-,29+/m1/s1 |
| InChIKey | NQHCBXGLXMPRAJ-YMHXRQESSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|