C33H51O3PSi2 — CID 146028212
2-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethoxy-diphenylphosphane (PubChem CID 146028212) has the molecular formula C33H51O3PSi2 and a molecular weight of 582.91 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethoxy-diphenylphosphane.
| Compound Name | 2-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethoxy-diphenylphosphane |
|---|---|
| PubChem CID | 146028212 |
| Molecular Formula | C33H51O3PSi2 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 2-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethoxy-diphenylphosphane |
| SMILES | C=C1[C@@H](O[Si](C)(C)C(C)(C)C)C/C(=C/COP(c2ccccc2)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H51O3PSi2/c1-26-30(35-38(8,9)32(2,3)4)24-27(25-31(26)36-39(10,11)33(5,6)7)22-23-34-37(28-18-14-12-15-19-28)29-20-16-13-17-21-29/h12-22,30-31H,1,23-25H2,2-11H3/b27-22-/t30-,31+/m0/s1 |
| InChIKey | RFIOEAXHEBHKPJ-MLVZICSGSA-N |
| XLogP | 9.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|