C33H51O3PSi2 — CID 87721408
[4-[2-[(4R,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-ylidene]ethyl]phenyl]-phenylphosphane (PubChem CID 87721408) has the molecular formula C33H51O3PSi2 and a molecular weight of 582.91 g/mol. Its IUPAC name is [4-[2-[(4R,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-ylidene]ethyl]phenyl]-phenylphosphane.
| Compound Name | [4-[2-[(4R,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-ylidene]ethyl]phenyl]-phenylphosphane |
|---|---|
| PubChem CID | 87721408 |
| Molecular Formula | C33H51O3PSi2 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | [4-[2-[(4R,8S)-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-1-oxaspiro[2.5]octan-6-ylidene]ethyl]phenyl]-phenylphosphane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C/C(=C/Cc2ccc(Pc3ccccc3)cc2)C[C@@H](O[Si](C)(C)C(C)(C)C)C12CO2 |
| InChI | InChI=1S/C33H51O3PSi2/c1-31(2,3)38(7,8)35-29-22-26(23-30(33(29)24-34-33)36-39(9,10)32(4,5)6)17-16-25-18-20-28(21-19-25)37-27-14-12-11-13-15-27/h11-15,17-21,29-30,37H,16,22-24H2,1-10H3/b26-17-/t29-,30+,33?/m0/s1 |
| InChIKey | HJBHNIYJMHDBII-LFNITTROSA-N |
| XLogP | 8.13 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|